C18H25NO4 — CID 838037
N-[2-(cyclohexen-1-yl)ethyl]-2,4,5-trimethoxybenzamide (PubChem CID 838037) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 838037 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)NCCC2=CCCCC2)cc1OC |
| InChI | InChI=1S/C18H25NO4/c1-21-15-12-17(23-3)16(22-2)11-14(15)18(20)19-10-9-13-7-5-4-6-8-13/h7,11-12H,4-6,8-10H2,1-3H3,(H,19,20) |
| InChIKey | BVTHKHGJFUXSEX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|