C19H24N2O3 — CID 113206869
N-[2-(cyclohexen-1-yl)ethyl]-5,6-dimethoxy-1H-indole-3-carboxamide (PubChem CID 113206869) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5,6-dimethoxy-1H-indole-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5,6-dimethoxy-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 113206869 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5,6-dimethoxy-1H-indole-3-carboxamide |
| SMILES | COc1cc2[nH]cc(C(=O)NCCC3=CCCCC3)c2cc1OC |
| InChI | InChI=1S/C19H24N2O3/c1-23-17-10-14-15(12-21-16(14)11-18(17)24-2)19(22)20-9-8-13-6-4-3-5-7-13/h6,10-12,21H,3-5,7-9H2,1-2H3,(H,20,22) |
| InChIKey | RPZSITCOBYYSFZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|