C16H19N3O — CID 106163847
6-amino-N-[2-(cyclopenten-1-yl)ethyl]-1H-indole-3-carboxamide (PubChem CID 106163847) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 6-amino-N-[2-(cyclopenten-1-yl)ethyl]-1H-indole-3-carboxamide.
| Compound Name | 6-amino-N-[2-(cyclopenten-1-yl)ethyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 106163847 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 6-amino-N-[2-(cyclopenten-1-yl)ethyl]-1H-indole-3-carboxamide |
| SMILES | Nc1ccc2c(C(=O)NCCC3=CCCC3)c[nH]c2c1 |
| InChI | InChI=1S/C16H19N3O/c17-12-5-6-13-14(10-19-15(13)9-12)16(20)18-8-7-11-3-1-2-4-11/h3,5-6,9-10,19H,1-2,4,7-8,17H2,(H,18,20) |
| InChIKey | DCRKDGZMUPXXMV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|