C11H11F2N3O — CID 115405243
6-amino-N-(2,2-difluoroethyl)-1H-indole-3-carboxamide (PubChem CID 115405243) has the molecular formula C11H11F2N3O and a molecular weight of 239.23 g/mol. Its IUPAC name is 6-amino-N-(2,2-difluoroethyl)-1H-indole-3-carboxamide.
| Compound Name | 6-amino-N-(2,2-difluoroethyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 115405243 |
| Molecular Formula | C11H11F2N3O |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 6-amino-N-(2,2-difluoroethyl)-1H-indole-3-carboxamide |
| SMILES | Nc1ccc2c(C(=O)NCC(F)F)c[nH]c2c1 |
| InChI | InChI=1S/C11H11F2N3O/c12-10(13)5-16-11(17)8-4-15-9-3-6(14)1-2-7(8)9/h1-4,10,15H,5,14H2,(H,16,17) |
| InChIKey | CYYJWKDLPYWBSM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|