C13H14F3N3O2 — CID 63824926
6-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-indole-3-carboxamide (PubChem CID 63824926) has the molecular formula C13H14F3N3O2 and a molecular weight of 301.27 g/mol. Its IUPAC name is 6-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-indole-3-carboxamide.
| Compound Name | 6-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 63824926 |
| Molecular Formula | C13H14F3N3O2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 6-amino-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-indole-3-carboxamide |
| SMILES | Nc1ccc2c(C(=O)NCCOCC(F)(F)F)c[nH]c2c1 |
| InChI | InChI=1S/C13H14F3N3O2/c14-13(15,16)7-21-4-3-18-12(20)10-6-19-11-5-8(17)1-2-9(10)11/h1-2,5-6,19H,3-4,7,17H2,(H,18,20) |
| InChIKey | IOYOFTPOKCMTJW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|