C11H12ClF3N2O2 — CID 55261445
2-amino-4-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide (PubChem CID 55261445) has the molecular formula C11H12ClF3N2O2 and a molecular weight of 296.68 g/mol. Its IUPAC name is 2-amino-4-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide.
| Compound Name | 2-amino-4-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 55261445 |
| Molecular Formula | C11H12ClF3N2O2 |
| Molecular Weight | 296.68 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2-amino-4-chloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide |
| SMILES | Nc1cc(Cl)ccc1C(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C11H12ClF3N2O2/c12-7-1-2-8(9(16)5-7)10(18)17-3-4-19-6-11(13,14)15/h1-2,5H,3-4,6,16H2,(H,17,18) |
| InChIKey | XDNJGOYODUQDSD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.68 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|