C11H10F5NO2 — CID 62865819
2,3-difluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide (PubChem CID 62865819) has the molecular formula C11H10F5NO2 and a molecular weight of 283.20 g/mol. Its IUPAC name is 2,3-difluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide.
| Compound Name | 2,3-difluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 62865819 |
| Molecular Formula | C11H10F5NO2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2,3-difluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide |
| SMILES | O=C(NCCOCC(F)(F)F)c1cccc(F)c1F |
| InChI | InChI=1S/C11H10F5NO2/c12-8-3-1-2-7(9(8)13)10(18)17-4-5-19-6-11(14,15)16/h1-3H,4-6H2,(H,17,18) |
| InChIKey | JMBKWMBFGDFZQV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|