C12H15F4N3O2 — CID 105386389
2-(ethylamino)-3-fluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-4-carboxamide (PubChem CID 105386389) has the molecular formula C12H15F4N3O2 and a molecular weight of 309.26 g/mol. Its IUPAC name is 2-(ethylamino)-3-fluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-4-carboxamide.
| Compound Name | 2-(ethylamino)-3-fluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105386389 |
| Molecular Formula | C12H15F4N3O2 |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-(ethylamino)-3-fluoro-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyridine-4-carboxamide |
| SMILES | CCNc1nccc(C(=O)NCCOCC(F)(F)F)c1F |
| InChI | InChI=1S/C12H15F4N3O2/c1-2-17-10-9(13)8(3-4-18-10)11(20)19-5-6-21-7-12(14,15)16/h3-4H,2,5-7H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | IIJYSVQQZVOAGA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|