C11H15FN4O2 — CID 105384864
2-(ethylamino)-3-fluoro-N-[2-(methylamino)-2-oxoethyl]pyridine-4-carboxamide (PubChem CID 105384864) has the molecular formula C11H15FN4O2 and a molecular weight of 254.26 g/mol. Its IUPAC name is 2-(ethylamino)-3-fluoro-N-[2-(methylamino)-2-oxoethyl]pyridine-4-carboxamide.
| Compound Name | 2-(ethylamino)-3-fluoro-N-[2-(methylamino)-2-oxoethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105384864 |
| Molecular Formula | C11H15FN4O2 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-(ethylamino)-3-fluoro-N-[2-(methylamino)-2-oxoethyl]pyridine-4-carboxamide |
| SMILES | CCNc1nccc(C(=O)NCC(=O)NC)c1F |
| InChI | InChI=1S/C11H15FN4O2/c1-3-14-10-9(12)7(4-5-15-10)11(18)16-6-8(17)13-2/h4-5H,3,6H2,1-2H3,(H,13,17)(H,14,15)(H,16,18) |
| InChIKey | DIQGWOMJXJZWHI-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |