C11H15FN4O3 — CID 106241241
N-[2-(2-amino-2-oxoethoxy)ethyl]-3-fluoro-2-(methylamino)pyridine-4-carboxamide (PubChem CID 106241241) has the molecular formula C11H15FN4O3 and a molecular weight of 270.26 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethoxy)ethyl]-3-fluoro-2-(methylamino)pyridine-4-carboxamide.
| Compound Name | N-[2-(2-amino-2-oxoethoxy)ethyl]-3-fluoro-2-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106241241 |
| Molecular Formula | C11H15FN4O3 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | N-[2-(2-amino-2-oxoethoxy)ethyl]-3-fluoro-2-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1nccc(C(=O)NCCOCC(N)=O)c1F |
| InChI | InChI=1S/C11H15FN4O3/c1-14-10-9(12)7(2-3-15-10)11(18)16-4-5-19-6-8(13)17/h2-3H,4-6H2,1H3,(H2,13,17)(H,14,15)(H,16,18) |
| InChIKey | IPUHGNLBETZYGZ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|