C13H21FN4O — CID 105385470
N-[4-(dimethylamino)butyl]-3-fluoro-2-(methylamino)pyridine-4-carboxamide (PubChem CID 105385470) has the molecular formula C13H21FN4O and a molecular weight of 268.34 g/mol. Its IUPAC name is N-[4-(dimethylamino)butyl]-3-fluoro-2-(methylamino)pyridine-4-carboxamide.
| Compound Name | N-[4-(dimethylamino)butyl]-3-fluoro-2-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105385470 |
| Molecular Formula | C13H21FN4O |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | N-[4-(dimethylamino)butyl]-3-fluoro-2-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1nccc(C(=O)NCCCCN(C)C)c1F |
| InChI | InChI=1S/C13H21FN4O/c1-15-12-11(14)10(6-8-16-12)13(19)17-7-4-5-9-18(2)3/h6,8H,4-5,7,9H2,1-3H3,(H,15,16)(H,17,19) |
| InChIKey | UJSPXTBIUKQVJB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|