C11H13FN6O — CID 105387292
3-fluoro-2-(methylamino)-N-[2-(triazol-1-yl)ethyl]pyridine-4-carboxamide (PubChem CID 105387292) has the molecular formula C11H13FN6O and a molecular weight of 264.26 g/mol. Its IUPAC name is 3-fluoro-2-(methylamino)-N-[2-(triazol-1-yl)ethyl]pyridine-4-carboxamide.
| Compound Name | 3-fluoro-2-(methylamino)-N-[2-(triazol-1-yl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105387292 |
| Molecular Formula | C11H13FN6O |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 3-fluoro-2-(methylamino)-N-[2-(triazol-1-yl)ethyl]pyridine-4-carboxamide |
| SMILES | CNc1nccc(C(=O)NCCn2ccnn2)c1F |
| InChI | InChI=1S/C11H13FN6O/c1-13-10-9(12)8(2-3-14-10)11(19)15-4-6-18-7-5-16-17-18/h2-3,5,7H,4,6H2,1H3,(H,13,14)(H,15,19) |
| InChIKey | JOFHBGSZKNTGBL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |