C12H18FN3OS — CID 105387455
3-fluoro-2-(methylamino)-N-(4-methylsulfanylbutyl)pyridine-4-carboxamide (PubChem CID 105387455) has the molecular formula C12H18FN3OS and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-fluoro-2-(methylamino)-N-(4-methylsulfanylbutyl)pyridine-4-carboxamide.
| Compound Name | 3-fluoro-2-(methylamino)-N-(4-methylsulfanylbutyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105387455 |
| Molecular Formula | C12H18FN3OS |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-fluoro-2-(methylamino)-N-(4-methylsulfanylbutyl)pyridine-4-carboxamide |
| SMILES | CNc1nccc(C(=O)NCCCCSC)c1F |
| InChI | InChI=1S/C12H18FN3OS/c1-14-11-10(13)9(5-7-15-11)12(17)16-6-3-4-8-18-2/h5,7H,3-4,6,8H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | QVRXNSDSJMHMQK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|