C13H17FN4O2 — CID 105387425
N-[2-(cyclopropanecarbonylamino)ethyl]-3-fluoro-2-(methylamino)pyridine-4-carboxamide (PubChem CID 105387425) has the molecular formula C13H17FN4O2 and a molecular weight of 280.30 g/mol. Its IUPAC name is N-[2-(cyclopropanecarbonylamino)ethyl]-3-fluoro-2-(methylamino)pyridine-4-carboxamide.
| Compound Name | N-[2-(cyclopropanecarbonylamino)ethyl]-3-fluoro-2-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105387425 |
| Molecular Formula | C13H17FN4O2 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | N-[2-(cyclopropanecarbonylamino)ethyl]-3-fluoro-2-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1nccc(C(=O)NCCNC(=O)C2CC2)c1F |
| InChI | InChI=1S/C13H17FN4O2/c1-15-11-10(14)9(4-5-16-11)13(20)18-7-6-17-12(19)8-2-3-8/h4-5,8H,2-3,6-7H2,1H3,(H,15,16)(H,17,19)(H,18,20) |
| InChIKey | DEXYMIWYHSBWLU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|