C13H18FN3O2 — CID 105385671
3-fluoro-2-(methylamino)-N-[2-(oxolan-2-yl)ethyl]pyridine-4-carboxamide (PubChem CID 105385671) has the molecular formula C13H18FN3O2 and a molecular weight of 267.30 g/mol. Its IUPAC name is 3-fluoro-2-(methylamino)-N-[2-(oxolan-2-yl)ethyl]pyridine-4-carboxamide.
| Compound Name | 3-fluoro-2-(methylamino)-N-[2-(oxolan-2-yl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105385671 |
| Molecular Formula | C13H18FN3O2 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-fluoro-2-(methylamino)-N-[2-(oxolan-2-yl)ethyl]pyridine-4-carboxamide |
| SMILES | CNc1nccc(C(=O)NCCC2CCCO2)c1F |
| InChI | InChI=1S/C13H18FN3O2/c1-15-12-11(14)10(5-7-16-12)13(18)17-6-4-9-3-2-8-19-9/h5,7,9H,2-4,6,8H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | GVMVLVDJTFMRJT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |