C10H13FN4O3 — CID 106241159
2-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-3-fluoropyridine-4-carboxamide (PubChem CID 106241159) has the molecular formula C10H13FN4O3 and a molecular weight of 256.24 g/mol. Its IUPAC name is 2-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-3-fluoropyridine-4-carboxamide.
| Compound Name | 2-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 106241159 |
| Molecular Formula | C10H13FN4O3 |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-amino-N-[2-(2-amino-2-oxoethoxy)ethyl]-3-fluoropyridine-4-carboxamide |
| SMILES | NC(=O)COCCNC(=O)c1ccnc(N)c1F |
| InChI | InChI=1S/C10H13FN4O3/c11-8-6(1-2-14-9(8)13)10(17)15-3-4-18-5-7(12)16/h1-2H,3-5H2,(H2,12,16)(H2,13,14)(H,15,17) |
| InChIKey | ZXANWWIBZVPKGI-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|