C10H12FN3O — CID 105384388
2-amino-N-(cyclopropylmethyl)-3-fluoropyridine-4-carboxamide (PubChem CID 105384388) has the molecular formula C10H12FN3O and a molecular weight of 209.22 g/mol. Its IUPAC name is 2-amino-N-(cyclopropylmethyl)-3-fluoropyridine-4-carboxamide.
| Compound Name | 2-amino-N-(cyclopropylmethyl)-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 105384388 |
| Molecular Formula | C10H12FN3O |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-amino-N-(cyclopropylmethyl)-3-fluoropyridine-4-carboxamide |
| SMILES | Nc1nccc(C(=O)NCC2CC2)c1F |
| InChI | InChI=1S/C10H12FN3O/c11-8-7(3-4-13-9(8)12)10(15)14-5-6-1-2-6/h3-4,6H,1-2,5H2,(H2,12,13)(H,14,15) |
| InChIKey | UDNYYYUQDJLBLG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |