C12H17FN4O2 — CID 105387071
2-amino-N-[2-(tert-butylamino)-2-oxoethyl]-3-fluoropyridine-4-carboxamide (PubChem CID 105387071) has the molecular formula C12H17FN4O2 and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-amino-N-[2-(tert-butylamino)-2-oxoethyl]-3-fluoropyridine-4-carboxamide.
| Compound Name | 2-amino-N-[2-(tert-butylamino)-2-oxoethyl]-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 105387071 |
| Molecular Formula | C12H17FN4O2 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-amino-N-[2-(tert-butylamino)-2-oxoethyl]-3-fluoropyridine-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)CNC(=O)c1ccnc(N)c1F |
| InChI | InChI=1S/C12H17FN4O2/c1-12(2,3)17-8(18)6-16-11(19)7-4-5-15-10(14)9(7)13/h4-5H,6H2,1-3H3,(H2,14,15)(H,16,19)(H,17,18) |
| InChIKey | DVNLFVTYFOSGJV-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |