C10H14FN3O3S — CID 105385347
2-amino-3-fluoro-N-(3-methylsulfonylpropyl)pyridine-4-carboxamide (PubChem CID 105385347) has the molecular formula C10H14FN3O3S and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-amino-3-fluoro-N-(3-methylsulfonylpropyl)pyridine-4-carboxamide.
| Compound Name | 2-amino-3-fluoro-N-(3-methylsulfonylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105385347 |
| Molecular Formula | C10H14FN3O3S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-amino-3-fluoro-N-(3-methylsulfonylpropyl)pyridine-4-carboxamide |
| SMILES | CS(=O)(=O)CCCNC(=O)c1ccnc(N)c1F |
| InChI | InChI=1S/C10H14FN3O3S/c1-18(16,17)6-2-4-14-10(15)7-3-5-13-9(12)8(7)11/h3,5H,2,4,6H2,1H3,(H2,12,13)(H,14,15) |
| InChIKey | OTWXHPWMEONWKF-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|