C8H9F2N3O3S — CID 105380386
2,3-difluoro-N-(2-sulfamoylethyl)pyridine-4-carboxamide (PubChem CID 105380386) has the molecular formula C8H9F2N3O3S and a molecular weight of 265.24 g/mol. Its IUPAC name is 2,3-difluoro-N-(2-sulfamoylethyl)pyridine-4-carboxamide.
| Compound Name | 2,3-difluoro-N-(2-sulfamoylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105380386 |
| Molecular Formula | C8H9F2N3O3S |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 2,3-difluoro-N-(2-sulfamoylethyl)pyridine-4-carboxamide |
| SMILES | NS(=O)(=O)CCNC(=O)c1ccnc(F)c1F |
| InChI | InChI=1S/C8H9F2N3O3S/c9-6-5(1-2-12-7(6)10)8(14)13-3-4-17(11,15)16/h1-2H,3-4H2,(H,13,14)(H2,11,15,16) |
| InChIKey | INSYMTXCCONTHJ-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|