C9H10F2N2O2 — CID 105380129
2,3-difluoro-N-(2-methoxyethyl)pyridine-4-carboxamide (PubChem CID 105380129) has the molecular formula C9H10F2N2O2 and a molecular weight of 216.19 g/mol. Its IUPAC name is 2,3-difluoro-N-(2-methoxyethyl)pyridine-4-carboxamide.
| Compound Name | 2,3-difluoro-N-(2-methoxyethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105380129 |
| Molecular Formula | C9H10F2N2O2 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 2,3-difluoro-N-(2-methoxyethyl)pyridine-4-carboxamide |
| SMILES | COCCNC(=O)c1ccnc(F)c1F |
| InChI | InChI=1S/C9H10F2N2O2/c1-15-5-4-13-9(14)6-2-3-12-8(11)7(6)10/h2-3H,4-5H2,1H3,(H,13,14) |
| InChIKey | ZCOFMHSTXKGYNE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|