C11H10F2N2OS — CID 107470805
2,3-difluoro-N-(2-prop-2-ynylsulfanylethyl)pyridine-4-carboxamide (PubChem CID 107470805) has the molecular formula C11H10F2N2OS and a molecular weight of 256.28 g/mol. Its IUPAC name is 2,3-difluoro-N-(2-prop-2-ynylsulfanylethyl)pyridine-4-carboxamide.
| Compound Name | 2,3-difluoro-N-(2-prop-2-ynylsulfanylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 107470805 |
| Molecular Formula | C11H10F2N2OS |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2,3-difluoro-N-(2-prop-2-ynylsulfanylethyl)pyridine-4-carboxamide |
| SMILES | C#CCSCCNC(=O)c1ccnc(F)c1F |
| InChI | InChI=1S/C11H10F2N2OS/c1-2-6-17-7-5-15-11(16)8-3-4-14-10(13)9(8)12/h1,3-4H,5-7H2,(H,15,16) |
| InChIKey | RJGKNGJDVFXYFS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|