C11H13N3OS — CID 106425176
5-amino-N-(2-prop-2-ynylsulfanylethyl)pyridine-2-carboxamide (PubChem CID 106425176) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 5-amino-N-(2-prop-2-ynylsulfanylethyl)pyridine-2-carboxamide.
| Compound Name | 5-amino-N-(2-prop-2-ynylsulfanylethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106425176 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 5-amino-N-(2-prop-2-ynylsulfanylethyl)pyridine-2-carboxamide |
| SMILES | C#CCSCCNC(=O)c1ccc(N)cn1 |
| InChI | InChI=1S/C11H13N3OS/c1-2-6-16-7-5-13-11(15)10-4-3-9(12)8-14-10/h1,3-4,8H,5-7,12H2,(H,13,15) |
| InChIKey | YZCOIPXKLBRUGL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|