C13H13N3OS2 — CID 106433595
3-amino-N-(2-prop-2-ynylsulfanylethyl)thieno[2,3-c]pyridine-2-carboxamide (PubChem CID 106433595) has the molecular formula C13H13N3OS2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 3-amino-N-(2-prop-2-ynylsulfanylethyl)thieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-(2-prop-2-ynylsulfanylethyl)thieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106433595 |
| Molecular Formula | C13H13N3OS2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 3-amino-N-(2-prop-2-ynylsulfanylethyl)thieno[2,3-c]pyridine-2-carboxamide |
| SMILES | C#CCSCCNC(=O)c1sc2cnccc2c1N |
| InChI | InChI=1S/C13H13N3OS2/c1-2-6-18-7-5-16-13(17)12-11(14)9-3-4-15-8-10(9)19-12/h1,3-4,8H,5-7,14H2,(H,16,17) |
| InChIKey | DTFMIJRLFCMXCC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|