C13H15N3OS — CID 113466186
3-amino-N-[(E)-pent-3-enyl]thieno[2,3-c]pyridine-2-carboxamide (PubChem CID 113466186) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 3-amino-N-[(E)-pent-3-enyl]thieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[(E)-pent-3-enyl]thieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 113466186 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-amino-N-[(E)-pent-3-enyl]thieno[2,3-c]pyridine-2-carboxamide |
| SMILES | C/C=C/CCNC(=O)c1sc2cnccc2c1N |
| InChI | InChI=1S/C13H15N3OS/c1-2-3-4-6-16-13(17)12-11(14)9-5-7-15-8-10(9)18-12/h2-3,5,7-8H,4,6,14H2,1H3,(H,16,17)/b3-2+ |
| InChIKey | HDNDSNZVXNQQOJ-NSCUHMNNSA-N |
| XLogP | 2.57 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|