C11H14N4O3S2 — CID 114289295
3-amino-N-(3-sulfamoylpropyl)thieno[2,3-c]pyridine-2-carboxamide (PubChem CID 114289295) has the molecular formula C11H14N4O3S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-amino-N-(3-sulfamoylpropyl)thieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-(3-sulfamoylpropyl)thieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114289295 |
| Molecular Formula | C11H14N4O3S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-amino-N-(3-sulfamoylpropyl)thieno[2,3-c]pyridine-2-carboxamide |
| SMILES | Nc1c(C(=O)NCCCS(N)(=O)=O)sc2cnccc12 |
| InChI | InChI=1S/C11H14N4O3S2/c12-9-7-2-4-14-6-8(7)19-10(9)11(16)15-3-1-5-20(13,17)18/h2,4,6H,1,3,5,12H2,(H,15,16)(H2,13,17,18) |
| InChIKey | YZEFZXXVZVJHPS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|