C13H17N3OS — CID 113269830
3-amino-N-(3-methylbutyl)thieno[2,3-c]pyridine-2-carboxamide (PubChem CID 113269830) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is 3-amino-N-(3-methylbutyl)thieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-(3-methylbutyl)thieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 113269830 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 3-amino-N-(3-methylbutyl)thieno[2,3-c]pyridine-2-carboxamide |
| SMILES | CC(C)CCNC(=O)c1sc2cnccc2c1N |
| InChI | InChI=1S/C13H17N3OS/c1-8(2)3-6-16-13(17)12-11(14)9-4-5-15-7-10(9)18-12/h4-5,7-8H,3,6,14H2,1-2H3,(H,16,17) |
| InChIKey | ZKXYULBFQPSVCN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |