C10H12N4OS — CID 83024926
3-amino-N',N'-dimethylthieno[2,3-c]pyridine-2-carbohydrazide (PubChem CID 83024926) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is 3-amino-N',N'-dimethylthieno[2,3-c]pyridine-2-carbohydrazide.
| Compound Name | 3-amino-N',N'-dimethylthieno[2,3-c]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 83024926 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 3-amino-N',N'-dimethylthieno[2,3-c]pyridine-2-carbohydrazide |
| SMILES | CN(C)NC(=O)c1sc2cnccc2c1N |
| InChI | InChI=1S/C10H12N4OS/c1-14(2)13-10(15)9-8(11)6-3-4-12-5-7(6)16-9/h3-5H,11H2,1-2H3,(H,13,15) |
| InChIKey | VJRNKZROEMCXQQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|