C9H14FN5O3S — CID 105387918
3-fluoro-2-hydrazinyl-N-(3-sulfamoylpropyl)pyridine-4-carboxamide (PubChem CID 105387918) has the molecular formula C9H14FN5O3S and a molecular weight of 291.31 g/mol. Its IUPAC name is 3-fluoro-2-hydrazinyl-N-(3-sulfamoylpropyl)pyridine-4-carboxamide.
| Compound Name | 3-fluoro-2-hydrazinyl-N-(3-sulfamoylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105387918 |
| Molecular Formula | C9H14FN5O3S |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-fluoro-2-hydrazinyl-N-(3-sulfamoylpropyl)pyridine-4-carboxamide |
| SMILES | NNc1nccc(C(=O)NCCCS(N)(=O)=O)c1F |
| InChI | InChI=1S/C9H14FN5O3S/c10-7-6(2-4-13-8(7)15-11)9(16)14-3-1-5-19(12,17)18/h2,4H,1,3,5,11H2,(H,13,15)(H,14,16)(H2,12,17,18) |
| InChIKey | GMELMASUGALMCR-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|