C14H14F2N4O — CID 105388258
3-fluoro-N-[2-(3-fluorophenyl)ethyl]-2-hydrazinylpyridine-4-carboxamide (PubChem CID 105388258) has the molecular formula C14H14F2N4O and a molecular weight of 292.29 g/mol. Its IUPAC name is 3-fluoro-N-[2-(3-fluorophenyl)ethyl]-2-hydrazinylpyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-[2-(3-fluorophenyl)ethyl]-2-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105388258 |
| Molecular Formula | C14H14F2N4O |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3-fluoro-N-[2-(3-fluorophenyl)ethyl]-2-hydrazinylpyridine-4-carboxamide |
| SMILES | NNc1nccc(C(=O)NCCc2cccc(F)c2)c1F |
| InChI | InChI=1S/C14H14F2N4O/c15-10-3-1-2-9(8-10)4-6-19-14(21)11-5-7-18-13(20-17)12(11)16/h1-3,5,7-8H,4,6,17H2,(H,18,20)(H,19,21) |
| InChIKey | PTMLMLHXORLOSJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|