C14H12F2N2O — CID 61293442
2-fluoro-N-[2-(3-fluorophenyl)ethyl]pyridine-4-carboxamide (PubChem CID 61293442) has the molecular formula C14H12F2N2O and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-fluoro-N-[2-(3-fluorophenyl)ethyl]pyridine-4-carboxamide.
| Compound Name | 2-fluoro-N-[2-(3-fluorophenyl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 61293442 |
| Molecular Formula | C14H12F2N2O |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-fluoro-N-[2-(3-fluorophenyl)ethyl]pyridine-4-carboxamide |
| SMILES | O=C(NCCc1cccc(F)c1)c1ccnc(F)c1 |
| InChI | InChI=1S/C14H12F2N2O/c15-12-3-1-2-10(8-12)4-6-18-14(19)11-5-7-17-13(16)9-11/h1-3,5,7-9H,4,6H2,(H,18,19) |
| InChIKey | BVVNAKXNOKKSKB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|