C14H11Cl2FN2O — CID 43400487
5,6-dichloro-N-[2-(3-fluorophenyl)ethyl]pyridine-3-carboxamide (PubChem CID 43400487) has the molecular formula C14H11Cl2FN2O and a molecular weight of 313.16 g/mol. Its IUPAC name is 5,6-dichloro-N-[2-(3-fluorophenyl)ethyl]pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[2-(3-fluorophenyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 43400487 |
| Molecular Formula | C14H11Cl2FN2O |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 5,6-dichloro-N-[2-(3-fluorophenyl)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCc1cccc(F)c1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl2FN2O/c15-12-7-10(8-19-13(12)16)14(20)18-5-4-9-2-1-3-11(17)6-9/h1-3,6-8H,4-5H2,(H,18,20) |
| InChIKey | RQMDKPVUAQVFFM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|