C12H20FN5O — CID 105387949
N-[2-(diethylamino)ethyl]-3-fluoro-2-hydrazinylpyridine-4-carboxamide (PubChem CID 105387949) has the molecular formula C12H20FN5O and a molecular weight of 269.32 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-3-fluoro-2-hydrazinylpyridine-4-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105387949 |
| Molecular Formula | C12H20FN5O |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1ccnc(NN)c1F |
| InChI | InChI=1S/C12H20FN5O/c1-3-18(4-2)8-7-16-12(19)9-5-6-15-11(17-14)10(9)13/h5-6H,3-4,7-8,14H2,1-2H3,(H,15,17)(H,16,19) |
| InChIKey | HOOSODFYMTUPFI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|