C11H17FN4O2 — CID 105388610
N-(2-ethoxypropyl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide (PubChem CID 105388610) has the molecular formula C11H17FN4O2 and a molecular weight of 256.28 g/mol. Its IUPAC name is N-(2-ethoxypropyl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide.
| Compound Name | N-(2-ethoxypropyl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105388610 |
| Molecular Formula | C11H17FN4O2 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | N-(2-ethoxypropyl)-3-fluoro-2-hydrazinylpyridine-4-carboxamide |
| SMILES | CCOC(C)CNC(=O)c1ccnc(NN)c1F |
| InChI | InChI=1S/C11H17FN4O2/c1-3-18-7(2)6-15-11(17)8-4-5-14-10(16-13)9(8)12/h4-5,7H,3,6,13H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | GDUJBVFNTUDVMC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|