C12H18FN5O3 — CID 105388578
3-fluoro-2-hydrazinyl-N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]pyridine-4-carboxamide (PubChem CID 105388578) has the molecular formula C12H18FN5O3 and a molecular weight of 299.31 g/mol. Its IUPAC name is 3-fluoro-2-hydrazinyl-N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]pyridine-4-carboxamide.
| Compound Name | 3-fluoro-2-hydrazinyl-N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105388578 |
| Molecular Formula | C12H18FN5O3 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3-fluoro-2-hydrazinyl-N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]pyridine-4-carboxamide |
| SMILES | COCCNC(=O)C(C)NC(=O)c1ccnc(NN)c1F |
| InChI | InChI=1S/C12H18FN5O3/c1-7(11(19)16-5-6-21-2)17-12(20)8-3-4-15-10(18-14)9(8)13/h3-4,7H,5-6,14H2,1-2H3,(H,15,18)(H,16,19)(H,17,20) |
| InChIKey | JJJSKEKAMIQNCI-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|