C13H17FN2O4 — CID 107676818
2-fluoro-4-hydroxy-N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]benzamide (PubChem CID 107676818) has the molecular formula C13H17FN2O4 and a molecular weight of 284.29 g/mol. Its IUPAC name is 2-fluoro-4-hydroxy-N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]benzamide.
| Compound Name | 2-fluoro-4-hydroxy-N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 107676818 |
| Molecular Formula | C13H17FN2O4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-fluoro-4-hydroxy-N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]benzamide |
| SMILES | COCCNC(=O)C(C)NC(=O)c1ccc(O)cc1F |
| InChI | InChI=1S/C13H17FN2O4/c1-8(12(18)15-5-6-20-2)16-13(19)10-4-3-9(17)7-11(10)14/h3-4,7-8,17H,5-6H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | RXGQDMRPPKWBSU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|