C11H14FNO2S — CID 104929818
2-fluoro-4-hydroxy-N-(1-methylsulfanylpropan-2-yl)benzamide (PubChem CID 104929818) has the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. Its IUPAC name is 2-fluoro-4-hydroxy-N-(1-methylsulfanylpropan-2-yl)benzamide.
| Compound Name | 2-fluoro-4-hydroxy-N-(1-methylsulfanylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 104929818 |
| Molecular Formula | C11H14FNO2S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-fluoro-4-hydroxy-N-(1-methylsulfanylpropan-2-yl)benzamide |
| SMILES | CSCC(C)NC(=O)c1ccc(O)cc1F |
| InChI | InChI=1S/C11H14FNO2S/c1-7(6-16-2)13-11(15)9-4-3-8(14)5-10(9)12/h3-5,7,14H,6H2,1-2H3,(H,13,15) |
| InChIKey | SYLXSMSVXKMPHZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |