C10H10FNO4 — CID 107674650
2-[(2-fluoro-4-hydroxybenzoyl)amino]propanoic acid (PubChem CID 107674650) has the molecular formula C10H10FNO4 and a molecular weight of 227.19 g/mol. Its IUPAC name is 2-[(2-fluoro-4-hydroxybenzoyl)amino]propanoic acid.
| Compound Name | 2-[(2-fluoro-4-hydroxybenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 107674650 |
| Molecular Formula | C10H10FNO4 |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 2-[(2-fluoro-4-hydroxybenzoyl)amino]propanoic acid |
| SMILES | CC(NC(=O)c1ccc(O)cc1F)C(=O)O |
| InChI | InChI=1S/C10H10FNO4/c1-5(10(15)16)12-9(14)7-3-2-6(13)4-8(7)11/h2-5,13H,1H3,(H,12,14)(H,15,16) |
| InChIKey | HRBLJXNWPFEXGV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |