C13H14FNO6 — CID 107820252
(2S)-2-[(2-fluoro-4-hydroxybenzoyl)amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 107820252) has the molecular formula C13H14FNO6 and a molecular weight of 299.25 g/mol. Its IUPAC name is (2S)-2-[(2-fluoro-4-hydroxybenzoyl)amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2S)-2-[(2-fluoro-4-hydroxybenzoyl)amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107820252 |
| Molecular Formula | C13H14FNO6 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (2S)-2-[(2-fluoro-4-hydroxybenzoyl)amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@H](NC(=O)c1ccc(O)cc1F)C(=O)O |
| InChI | InChI=1S/C13H14FNO6/c1-21-11(17)5-4-10(13(19)20)15-12(18)8-3-2-7(16)6-9(8)14/h2-3,6,10,16H,4-5H2,1H3,(H,15,18)(H,19,20)/t10-/m0/s1 |
| InChIKey | GFPSZKAAVOLSEY-JTQLQIEISA-N |
| XLogP | 0.67 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |