C13H13F2NO5 — CID 107820571
(2R)-2-[(2,6-difluorobenzoyl)amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 107820571) has the molecular formula C13H13F2NO5 and a molecular weight of 301.25 g/mol. Its IUPAC name is (2R)-2-[(2,6-difluorobenzoyl)amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2R)-2-[(2,6-difluorobenzoyl)amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107820571 |
| Molecular Formula | C13H13F2NO5 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | (2R)-2-[(2,6-difluorobenzoyl)amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@@H](NC(=O)c1c(F)cccc1F)C(=O)O |
| InChI | InChI=1S/C13H13F2NO5/c1-21-10(17)6-5-9(13(19)20)16-12(18)11-7(14)3-2-4-8(11)15/h2-4,9H,5-6H2,1H3,(H,16,18)(H,19,20)/t9-/m1/s1 |
| InChIKey | SNHIUDIKONIXOO-SECBINFHSA-N |
| XLogP | 1.10 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |