C13H15NO7 — CID 107820519
(2R)-2-[(2,4-dihydroxybenzoyl)amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 107820519) has the molecular formula C13H15NO7 and a molecular weight of 297.26 g/mol. Its IUPAC name is (2R)-2-[(2,4-dihydroxybenzoyl)amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2R)-2-[(2,4-dihydroxybenzoyl)amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107820519 |
| Molecular Formula | C13H15NO7 |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (2R)-2-[(2,4-dihydroxybenzoyl)amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@@H](NC(=O)c1ccc(O)cc1O)C(=O)O |
| InChI | InChI=1S/C13H15NO7/c1-21-11(17)5-4-9(13(19)20)14-12(18)8-3-2-7(15)6-10(8)16/h2-3,6,9,15-16H,4-5H2,1H3,(H,14,18)(H,19,20)/t9-/m1/s1 |
| InChIKey | QSANCKBFGHCMDO-SECBINFHSA-N |
| XLogP | 0.23 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |