C13H14ClNO6 — CID 106500403
2-[(2-chloro-5-hydroxybenzoyl)amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 106500403) has the molecular formula C13H14ClNO6 and a molecular weight of 315.71 g/mol. Its IUPAC name is 2-[(2-chloro-5-hydroxybenzoyl)amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | 2-[(2-chloro-5-hydroxybenzoyl)amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 106500403 |
| Molecular Formula | C13H14ClNO6 |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2-[(2-chloro-5-hydroxybenzoyl)amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CCC(NC(=O)c1cc(O)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C13H14ClNO6/c1-21-11(17)5-4-10(13(19)20)15-12(18)8-6-7(16)2-3-9(8)14/h2-3,6,10,16H,4-5H2,1H3,(H,15,18)(H,19,20) |
| InChIKey | ODAQPHSWBGKVEE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |