C13H13Cl2NO5 — CID 82780716
2-[(2,4-dichlorobenzoyl)amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 82780716) has the molecular formula C13H13Cl2NO5 and a molecular weight of 334.16 g/mol. Its IUPAC name is 2-[(2,4-dichlorobenzoyl)amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | 2-[(2,4-dichlorobenzoyl)amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 82780716 |
| Molecular Formula | C13H13Cl2NO5 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 2-[(2,4-dichlorobenzoyl)amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CCC(NC(=O)c1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C13H13Cl2NO5/c1-21-11(17)5-4-10(13(19)20)16-12(18)8-3-2-7(14)6-9(8)15/h2-3,6,10H,4-5H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | CLQJQNCKXKVQFO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |