C12H13Cl2NO5S — CID 25323237
(2R)-2-[(2,4-dichlorobenzoyl)amino]-4-methylsulfonylbutanoic acid (PubChem CID 25323237) has the molecular formula C12H13Cl2NO5S and a molecular weight of 354.21 g/mol. Its IUPAC name is (2R)-2-[(2,4-dichlorobenzoyl)amino]-4-methylsulfonylbutanoic acid.
| Compound Name | (2R)-2-[(2,4-dichlorobenzoyl)amino]-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 25323237 |
| Molecular Formula | C12H13Cl2NO5S |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | (2R)-2-[(2,4-dichlorobenzoyl)amino]-4-methylsulfonylbutanoic acid |
| SMILES | CS(=O)(=O)CC[C@@H](NC(=O)c1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H13Cl2NO5S/c1-21(19,20)5-4-10(12(17)18)15-11(16)8-3-2-7(13)6-9(8)14/h2-3,6,10H,4-5H2,1H3,(H,15,16)(H,17,18)/t10-/m1/s1 |
| InChIKey | URWHVFRTJGXWAS-SNVBAGLBSA-N |
| XLogP | 1.61 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |