2-[(2,4-dichlorobenzoyl)amino]-3-methylsulfanylpropanoic acid

C11H11Cl2NO3S — CID 110189851

IUPAC2-[(2,4-dichlorobenzoyl)amino]-3-methylsulfanylpropanoic acid
SMILESCSCC(NC(=O)c1ccc(Cl)cc1Cl)C(=O)O
InChIInChI=1S/C11H11Cl2NO3S/c1-18-5-9(11(16)17)14-10(15)7-3-2-6(12)4-8(7)13/h2-4,9H,5H2,1H3,(H,14,15)(H,16,17)
InChIKeyKXMVWJVZEOPRSR-UHFFFAOYSA-N
MW308.19 g/mol
LogP2.54
Rot. Bonds5

About 2-[(2,4-dichlorobenzoyl)amino]-3-methylsulfanylpropanoic acid

2-[(2,4-dichlorobenzoyl)amino]-3-methylsulfanylpropanoic acid (PubChem CID 110189851) has the molecular formula C11H11Cl2NO3S and a molecular weight of 308.19 g/mol. Its IUPAC name is 2-[(2,4-dichlorobenzoyl)amino]-3-methylsulfanylpropanoic acid.

Molecular Properties

Compound Name2-[(2,4-dichlorobenzoyl)amino]-3-methylsulfanylpropanoic acid
PubChem CID110189851
Molecular FormulaC11H11Cl2NO3S
Molecular Weight308.19 g/mol
Exact Mass306.98
IUPAC Name2-[(2,4-dichlorobenzoyl)amino]-3-methylsulfanylpropanoic acid
SMILESCSCC(NC(=O)c1ccc(Cl)cc1Cl)C(=O)O
InChIInChI=1S/C11H11Cl2NO3S/c1-18-5-9(11(16)17)14-10(15)7-3-2-6(12)4-8(7)13/h2-4,9H,5H2,1H3,(H,14,15)(H,16,17)
InChIKeyKXMVWJVZEOPRSR-UHFFFAOYSA-N
XLogP2.54
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.19
LogP ≤ 52.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[(2,4-dichlorobenzoyl)amino]-3-methylsulfanylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,4-dichlorobenzoyl)amino]-3-methylsulfanylpropanoic acid?
The IUPAC name of 2-[(2,4-dichlorobenzoyl)amino]-3-methylsulfanylpropanoic acid (CID 110189851) is 2-[(2,4-dichlorobenzoyl)amino]-3-methylsulfanylpropanoic acid.
What is the SMILES notation for 2-[(2,4-dichlorobenzoyl)amino]-3-methylsulfanylpropanoic acid?
The canonical SMILES for 2-[(2,4-dichlorobenzoyl)amino]-3-methylsulfanylpropanoic acid is CSCC(NC(=O)c1ccc(Cl)cc1Cl)C(=O)O.
What is the InChIKey of 2-[(2,4-dichlorobenzoyl)amino]-3-methylsulfanylpropanoic acid?
The InChIKey is KXMVWJVZEOPRSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2NO3S/c1-18-5-9(11(16)17)14-10(15)7-3-2-6(12)4-8(7)13/h2-4,9H,5H2,1H3,(H,14,15)(H,16,17).
What are the key properties of 2-[(2,4-dichlorobenzoyl)amino]-3-methylsulfanylpropanoic acid?
2-[(2,4-dichlorobenzoyl)amino]-3-methylsulfanylpropanoic acid has a molecular weight of 308.19 g/mol, XLogP of 2.54, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dichlorobenzoyl)amino]-3-methylsulfanylpropanoic acid is sourced from PubChem (CID 110189851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).