C13H14Cl2N2O4S — CID 110189772
3-(3-amino-3-oxopropyl)sulfanyl-2-[(2,4-dichlorobenzoyl)amino]propanoic acid (PubChem CID 110189772) has the molecular formula C13H14Cl2N2O4S and a molecular weight of 365.24 g/mol. Its IUPAC name is 3-(3-amino-3-oxopropyl)sulfanyl-2-[(2,4-dichlorobenzoyl)amino]propanoic acid.
| Compound Name | 3-(3-amino-3-oxopropyl)sulfanyl-2-[(2,4-dichlorobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 110189772 |
| Molecular Formula | C13H14Cl2N2O4S |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 3-(3-amino-3-oxopropyl)sulfanyl-2-[(2,4-dichlorobenzoyl)amino]propanoic acid |
| SMILES | NC(=O)CCSCC(NC(=O)c1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C13H14Cl2N2O4S/c14-7-1-2-8(9(15)5-7)12(19)17-10(13(20)21)6-22-4-3-11(16)18/h1-2,5,10H,3-4,6H2,(H2,16,18)(H,17,19)(H,20,21) |
| InChIKey | AHGPYXUBMQPLJA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|