C13H16Cl2N2O2 — CID 40804285
N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-2,4-dichlorobenzamide (PubChem CID 40804285) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 40804285 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-2,4-dichlorobenzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(Cl)cc1Cl)C(N)=O |
| InChI | InChI=1S/C13H16Cl2N2O2/c1-7(2)5-11(12(16)18)17-13(19)9-4-3-8(14)6-10(9)15/h3-4,6-7,11H,5H2,1-2H3,(H2,16,18)(H,17,19)/t11-/m0/s1 |
| InChIKey | DTJRGYLJNAYDDM-NSHDSACASA-N |
| XLogP | 2.62 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |