C20H20Cl3N3O3 — CID 52510980
2,4-dichloro-N-[(2S)-1-[2-(2-chlorobenzoyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 52510980) has the molecular formula C20H20Cl3N3O3 and a molecular weight of 456.76 g/mol. Its IUPAC name is 2,4-dichloro-N-[(2S)-1-[2-(2-chlorobenzoyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[(2S)-1-[2-(2-chlorobenzoyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 52510980 |
| Molecular Formula | C20H20Cl3N3O3 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 2,4-dichloro-N-[(2S)-1-[2-(2-chlorobenzoyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(Cl)cc1Cl)C(=O)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H20Cl3N3O3/c1-11(2)9-17(24-18(27)14-8-7-12(21)10-16(14)23)20(29)26-25-19(28)13-5-3-4-6-15(13)22/h3-8,10-11,17H,9H2,1-2H3,(H,24,27)(H,25,28)(H,26,29)/t17-/m0/s1 |
| InChIKey | RUGWGENOZULQQP-KRWDZBQOSA-N |
| XLogP | 4.25 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|