C16H22Cl2N2O3 — CID 98001708
2,4-dichloro-N-[(2S)-1-(3-hydroxypropylamino)-4-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 98001708) has the molecular formula C16H22Cl2N2O3 and a molecular weight of 361.27 g/mol. Its IUPAC name is 2,4-dichloro-N-[(2S)-1-(3-hydroxypropylamino)-4-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[(2S)-1-(3-hydroxypropylamino)-4-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 98001708 |
| Molecular Formula | C16H22Cl2N2O3 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 2,4-dichloro-N-[(2S)-1-(3-hydroxypropylamino)-4-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(Cl)cc1Cl)C(=O)NCCCO |
| InChI | InChI=1S/C16H22Cl2N2O3/c1-10(2)8-14(16(23)19-6-3-7-21)20-15(22)12-5-4-11(17)9-13(12)18/h4-5,9-10,14,21H,3,6-8H2,1-2H3,(H,19,23)(H,20,22)/t14-/m0/s1 |
| InChIKey | FSEYXXDUXJPASN-AWEZNQCLSA-N |
| XLogP | 2.64 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|