C20H27Cl2N3O3 — CID 43006168
2,4-dichloro-N-[4-methyl-1-oxo-1-[3-(2-oxopyrrolidin-1-yl)propylamino]pentan-2-yl]benzamide (PubChem CID 43006168) has the molecular formula C20H27Cl2N3O3 and a molecular weight of 428.36 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-methyl-1-oxo-1-[3-(2-oxopyrrolidin-1-yl)propylamino]pentan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-methyl-1-oxo-1-[3-(2-oxopyrrolidin-1-yl)propylamino]pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 43006168 |
| Molecular Formula | C20H27Cl2N3O3 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2,4-dichloro-N-[4-methyl-1-oxo-1-[3-(2-oxopyrrolidin-1-yl)propylamino]pentan-2-yl]benzamide |
| SMILES | CC(C)CC(NC(=O)c1ccc(Cl)cc1Cl)C(=O)NCCCN1CCCC1=O |
| InChI | InChI=1S/C20H27Cl2N3O3/c1-13(2)11-17(24-19(27)15-7-6-14(21)12-16(15)22)20(28)23-8-4-10-25-9-3-5-18(25)26/h6-7,12-13,17H,3-5,8-11H2,1-2H3,(H,23,28)(H,24,27) |
| InChIKey | MRXOLMBLTTWJKY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|